एड्रेनेलिन के संपादन कइल जा रहल बा

{{drugbox
| drug_name = Epinephrine
| synonyms = Epinephrine, adrenaline, adrenalin
| IUPAC_name = (''R'')-4-(1-Hydroxy-2-(methylamino)ethyl)benzene-1,2-diol
| image = Epinephrine.svg
| width = 300
| alt = Skeletal formula of adrenaline
| caption = [[Skeletal formula]] of adrenaline
| image2 = Adrenaline-from-xtal-3D-bs-17.png
| caption2 = [[Ball-and-stick model]] of the [[zwitterion]]ic form of adrenaline found in the [[crystal structure]]<ref>{{ cite journal | title = Structural Studies of Metabolic Products of Dopamine. III. Crystal and Molecular Structure of (−)-Adrenaline. | vauthors =  Andersen AM | journal = [[Acta Chemica Scandinavica|Acta Chem. Scand.]] | volume = 29b | pages = 239-244 | year = 1975 | doi = 10.3891/acta.chem.scand.29b-0239 | doi-access = free }}</ref>
| alt2 = Ball-and-stick model of epinephrine (adrenaline) molecule

<!--Clinical data-->
| tradename = EpiPen, Adrenaclick, others
| Drugs.com = {{drugs.com|monograph|epinephrine}}
| MedlinePlus = a603002
| DailyMedID = EpiPen
| pregnancy_US = N
| pregnancy_AU = A
| pregnancy_category=
| legal_AU = S4
| legal_UK = POM
| legal_US = Rx-only
| legal_US_comment = 
| legal_status=
| licence_US = Epinephrine
| licence_EU=
| routes_of_administration = [[intravenous|IV]], [[intramuscular|IM]], [[endotracheal tube|endotracheal]], [[Intracardiac injection|IC]], [[Nasal administration|nasal]], [[eye drop]]
| addiction_liability = None
| ATC_prefix = A01
| ATC_suffix = AD01
| ATC_supplemental = {{ATC|B02|BC09}} {{ATC|C01|CA24}} {{ATC|R01|AA14}} {{ATC|R03|AA01}} {{ATC|S01|EA01}}

<!--Chemical data-->
| C=9 | H=13 | N=1 | O=3
| SMILES =  CNC[C@H](O)c1ccc(O)c(O)c1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UCTWMZQNUQWSLP-VIFPVBQESA-N
| density=1.283±0.06
| density_notes = @&nbsp;20&nbsp;°C, 760 Torr
| protein_bound=15–20%<ref name="El-Bahr Kahlbacher Patzl Palme 2006 pp. 423–432">{{cite journal | vauthors = El-Bahr SM, Kahlbacher H, Patzl M, Palme RG | title = Binding and clearance of radioactive adrenaline and noradrenaline in sheep blood | journal = Veterinary Research Communications | volume = 30 | issue = 4 | pages = 423–32 | date = May 2006 | pmid = 16502110 | doi = 10.1007/s11259-006-3244-1 | publisher = Springer Science and Business Media LLC | s2cid = 9054777 }}</ref><ref name="Franksson Änggård pp. 209–214">{{cite journal | vauthors = Franksson G, Anggård E | title = The plasma protein binding of amphetamine, catecholamines and related compounds | journal = Acta Pharmacologica Et Toxicologica | volume = 28 | issue = 3 | pages = 209–14 | date = 2009-03-13 | pmid = 5468075 | doi = 10.1111/j.1600-0773.1970.tb00546.x | publisher = Wiley }}</ref>
|metabolites=[[Metanephrine]]<ref name="Peaston Weinkove pp. 17–38">{{cite journal | vauthors = Peaston RT, Weinkove C | title = Measurement of catecholamines and their metabolites | journal = Annals of Clinical Biochemistry | volume = 41 | issue = Pt 1 | pages = 17–38 | date = January 2004 | pmid = 14713382 | doi = 10.1258/000456304322664663 | publisher = SAGE Publications | doi-access = free }}</ref>
|receptors=[[Adrenergic receptors]]
}}
'''एड्रेनेलिन''' (Adrenaline) जेकरा के '''एपिनेफ्राइन''' (Epinephrine) के नाँव से भी जानल जाला, एगो [[हार्मोन]] आ [[दवाई]] हवे।<ref name=Chan2013>{{cite book | first1 = Michael | last1 = Lieberman | first2 = Allan | last2 = Marks | first3 = Alisa | last3 = Peet | name-list-style = vanc | title=Marks' Basic Medical Biochemistry: A Clinical Approach | date = 2013 | publisher = Wolters Kluwer Health/Lippincott Williams & Wilkins | location = Philadelphia | isbn = 9781608315727 | page = 175 | edition = 4th | url = https://books.google.com/books?id=3FNYdShrCwIC&pg=PA175 }}</ref><ref>{{cite web |url= http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=479|title=(-)-adrenaline|date=21 August 2015 }}</ref> ई शरीर के विसरल फंक्शन, मने कि अपने आप संचालित होखे वाला अंदरूनी क्रिया सभ, जइसे कि साँस लिहल इत्यादि के रेगुलेट करे ला। शरीर में आमतौर प एकर उत्पादन [[एड्रेनेलिन ग्लैंड]] में होला आ कुछ मात्रा में ई [[मेडुला ऑब्लांगाटा]] के [[न्यूरान]] सभ द्वारा उत्पादित कइल जाला। ई हार्मोन के रूप में, [[लड़े-चाहे-भागे के रिस्पांस]] में बहुत महत्व के भूमिका वाला चीज हवे, मांसपेशी सभ में खून के बहाव बढ़ा के, दिल के धड़के के गति तेज क के, आँख के पुतरी में फइलाव ले आ के आ खून में शुगर के लेवल रेगुलेट क के ई आपन काम करे ला। ई हार्मोन कई जानवर सभ में पावल जाला आ कुक एक कोशिका वाला जीव सभ में भी मिले ला। पोलैंड के फिजियोलॉजिस्ट नेपोलियन सायबुल्सकी पहिली बेर एकरा के 1895 में आइसोलेट करे में सफल भइल रहलें।

{{clear}}
== संदर्भ ==
{{Reflist|33em}}

[[श्रेणी:एड्रेनेलिन| ]]
[[श्रेणी:हार्मोन]]

{{med-stub}}